Drugs Information: Velpatasvir
Basic Information
|
||
| ID | DDInter1924 | |
| Drug Type | small molecule | |
| Molecular Formula | C49H54N8O8 | |
| Molecular Weight | 883.019 | |
| Description | Velpatasvir is a NS5A inhibitor used to treat chronic hepatitis C infections in patients without cirrhosis or with compensated cirrhosis. | |
| ATC Classification | J05AP55 J05AP56 | |
| IUPAC Name | Methyl N-[(1R)-2-[(2S,4S)-2-(5-{6-[(2S,5S)-1-[(2S)-2-[(Methoxycarbonyl)Amino]-3-Methylbutanoyl]-5-Methylpyrrolidin-2-Yl]-21-Oxa- | |
| InChI | Inchi=1S/C49H54N8O8/C1-26(2)41(54-48(60)63-5)47(59)57-27(3)12-17-38(57)45-51-36-16-14-30-20-35-33-15-13-31(19-32(33)25-65-40(35)21-34(30)43(36)53-45)37-22-50-44(52-37)39-18-28(24-62-4)23-56(39)46(58)42(55-49(61)64-6)29-10-8-7-9-11-29/H7-11,13-16,19-22,26-28,38-39,41-42H,12,17-18,23-25H2,1-6H3,(H,50,52)(H,51,53)(H,54,60)(H,55,61)/T27-,28-,38-,39-,41-,42+/M0/S1 | |
| InChI Key | FHCUMDQMBHQXKK-CDIODLITSA-N | |
| Canonical SMILES | COC[C@H]1C[C@H](N(C1)C(=O)[C@H](NC(=O)OC)C1=CC=CC=C1)C1=NC=C(N1)C1=CC=C2C(COC3=CC4=C(C=CC5=C4NC(=N5)[C@@H]4CC[C@H](C)N4C(=O)[C@@H](NC(=O)OC)C(C)C)C=C23)=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Velpatasvir
| Severity level | ID | Name | Mechanism | Detail |
|---|