Drugs Information: Verteporfin
Basic Information
|
||
| ID | DDInter1929 | |
| Drug Type | small molecule | |
| Molecular Formula | C41H42N4O8 | |
| Molecular Weight | 718.807 | |
| Description | Verteporfin is a benzoporphyrin derivative used to treat pathological myopia, ocular histoplasmosis, and choroidal neovascularization in macular degeneration. | |
| ATC Classification | S01LA01 | |
| IUPAC Name | 3-[(23S,24R)-14-Ethenyl-5-(3-Methoxy-3-Oxopropyl)-22,23-Bis(Methoxycarbonyl)-4,10,15,24-Tetramethyl-25,26,27,28-Tetraazahexacycl | |
| InChI | Inchi=1S/C41H42N4O8/C1-9-23-20(2)29-17-34-27-13-10-26(39(49)52-7)38(40(50)53-8)41(27,5)35(45-34)19-30-22(4)25(12-15-37(48)51-6)33(44-30)18-32-24(11-14-36(46)47)21(3)28(43-32)16-31(23)42-29/H9-10,13,16-19,38,42,44H,1,11-12,14-15H2,2-8H3,(H,46,47)/B28-16-,29-17-,30-19-,31-16-,32-18-,33-18-,34-17-,35-19-/T38-,41+/M0/S1 | |
| InChI Key | YTZALCGQUPRCGW-MXVXOLGGSA-N | |
| Canonical SMILES | COC(=O)CCC1=C2NC(\C=C3/N=C(/C=C4\N\C(=C/C5=N/C(=C\2)/C(CCC(O)=O)=C5C)C(C=C)=C4C)C2=CC=C([C@@H](C(=O)OC)[C@@]32C)C(=O)OC)=C1C | |
| Useful Links | DrugBank PubChem | |
Interactions with Verteporfin
| Severity level | ID | Name | Mechanism | Detail |
|---|