Drugs Information: Vilazodone
Basic Information
|
||
| ID | DDInter1935 | |
| Drug Type | small molecule | |
| Molecular Formula | C26H27N5O2 | |
| Molecular Weight | 441.535 | |
| Description | Vilazodone is an antidepressant agent used for the treatment of major depressive disorder that targets the 5-HT transporter and 5-HT1A receptors. | |
| ATC Classification | N06AX24 | |
| IUPAC Name | 5-{4-[4-(5-Cyano-1H-Indol-3-Yl)Butyl]Piperazin-1-Yl}-1-Benzofuran-2-Carboxamide | |
| InChI | Inchi=1S/C26H27N5O2/C27-16-18-4-6-23-22(13-18)19(17-29-23)3-1-2-8-30-9-11-31(12-10-30)21-5-7-24-20(14-21)15-25(33-24)26(28)32/H4-7,13-15,17,29H,1-3,8-12H2,(H2,28,32) | |
| InChI Key | SGEGOXDYSFKCPT-UHFFFAOYSA-N | |
| Canonical SMILES | NC(=O)C1=CC2=CC(=CC=C2O1)N1CCN(CCCCC2=CNC3=C2C=C(C=C3)C#N)CC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Vilazodone
| Severity level | ID | Name | Mechanism | Detail |
|---|