Drugs Information: Vorinostat
Basic Information
|
||
| ID | DDInter1947 | |
| Drug Type | small molecule | |
| Molecular Formula | C14H20N2O3 | |
| Molecular Weight | 264.325 | |
| Description | Vorinostat is a histone deacetylase (HDAC) inhibitor used for the treatment of cutaneous manifestations in patients with progressive, persistent, or recurrent cutaneous T- cell lymphoma (CTCL) following prior systemic therapies. | |
| ATC Classification | L01XX38 | |
| IUPAC Name | N-Hydroxy-N'-Phenyloctanediamide | |
| InChI | Inchi=1S/C14H20N2O3/C17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/H3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18) | |
| InChI Key | WAEXFXRVDQXREF-UHFFFAOYSA-N | |
| Canonical SMILES | ONC(=O)CCCCCCC(=O)NC1=CC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Vorinostat
| Severity level | ID | Name | Mechanism | Detail |
|---|