Drugs Information: Zafirlukast
Basic Information
|
||
| ID | DDInter1955 | |
| Drug Type | small molecule | |
| Molecular Formula | C31H33N3O6S | |
| Molecular Weight | 575.686 | |
| Description | Zafirlukast is a leukotriene receptor antagonist used for prophylaxis and chronic treatment of asthma. | |
| ATC Classification | R03DC01 | |
| IUPAC Name | Cyclopentyl N-[3-({2-Methoxy-4-[(2-Methylbenzenesulfonyl)Carbamoyl]Phenyl}Methyl)-1-Methyl-1H-Indol-5-Yl]Carbamate | |
| InChI | Inchi=1S/C31H33N3O6S/C1-20-8-4-7-11-29(20)41(37,38)33-30(35)22-13-12-21(28(17-22)39-3)16-23-19-34(2)27-15-14-24(18-26(23)27)32-31(36)40-25-9-5-6-10-25/H4,7-8,11-15,17-19,25H,5-6,9-10,16H2,1-3H3,(H,32,36)(H,33,35) | |
| InChI Key | YEEZWCHGZNKEEK-UHFFFAOYSA-N | |
| Canonical SMILES | COC1=CC(=CC=C1CC1=CN(C)C2=C1C=C(NC(=O)OC1CCCC1)C=C2)C(=O)NS(=O)(=O)C1=CC=CC=C1C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Zafirlukast
| Severity level | ID | Name | Mechanism | Detail |
|---|