Drugs Information: Zoledronic acid
Basic Information
|
||
| ID | DDInter1968 | |
| Drug Type | small molecule | |
| Molecular Formula | C5H10N2O7P2 | |
| Molecular Weight | 272.090 | |
| Description | Zoledronic acid is a bisphosphonate used to treat malignancy associated hypercalcemia, multiple myeloma, and bone metastasis from solid tumors. | |
| ATC Classification | M05BB08 M05BA08 | |
| IUPAC Name | [1-Hydroxy-2-(1H-Imidazol-1-Yl)-1-Phosphonoethyl]Phosphonic Acid | |
| InChI | Inchi=1S/C5H10N2O7P2/C8-5(15(9,10)11,16(12,13)14)3-7-2-1-6-4-7/H1-2,4,8H,3H2,(H2,9,10,11)(H2,12,13,14) | |
| InChI Key | XRASPMIURGNCCH-UHFFFAOYSA-N | |
| Canonical SMILES | OC(CN1C=CN=C1)(P(O)(O)=O)P(O)(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Zoledronic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|