Drugs Information: Betrixaban
Basic Information
|
||
| ID | DDInter200 | |
| Drug Type | small molecule | |
| Molecular Formula | C23H22Cln5O3 | |
| Molecular Weight | 451.914 | |
| Description | Betrixaban is a Factor Xa inhibitor used for prophylaxis of venous thromboembolism in hospitalized patients. | |
| ATC Classification | B01AF04 | |
| IUPAC Name | N-(5-Chloropyridin-2-Yl)-2-[4-(N,N-Dimethylcarbamimidoyl)Benzamido]-5-Methoxybenzamide | |
| InChI | Inchi=1S/C23H22Cln5O3/C1-29(2)21(25)14-4-6-15(7-5-14)22(30)27-19-10-9-17(32-3)12-18(19)23(31)28-20-11-8-16(24)13-26-20/H4-13,25H,1-3H3,(H,27,30)(H,26,28,31) | |
| InChI Key | XHOLNRLADUSQLD-UHFFFAOYSA-N | |
| Canonical SMILES | COC1=CC=C(NC(=O)C2=CC=C(C=C2)C(=N)N(C)C)C(=C1)C(=O)NC1=CC=C(Cl)C=N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Betrixaban
| Severity level | ID | Name | Mechanism | Detail |
|---|