Drugs Information: Bicalutamide
Basic Information
|
||
| ID | DDInter204 | |
| Drug Type | small molecule | |
| Molecular Formula | C18H14F4N2O4S | |
| Molecular Weight | 430.378 | |
| Description | Bicalutamide is an androgen receptor inhibitor used to treat Stage D2 metastatic carcinoma of the prostate. | |
| ATC Classification | L02BB03 L02AE51 | |
| IUPAC Name | N-[4-Cyano-3-(Trifluoromethyl)Phenyl]-3-(4-Fluorobenzenesulfonyl)-2-Hydroxy-2-Methylpropanamide | |
| InChI | Inchi=1S/C18H14F4N2O4S/C1-17(26,10-29(27,28)14-6-3-12(19)4-7-14)16(25)24-13-5-2-11(9-23)15(8-13)18(20,21)22/H2-8,26H,10H2,1H3,(H,24,25) | |
| InChI Key | LKJPYSCBVHEWIU-UHFFFAOYSA-N | |
| Canonical SMILES | CC(O)(CS(=O)(=O)C1=CC=C(F)C=C1)C(=O)NC1=CC(=C(C=C1)C#N)C(F)(F)F | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Bicalutamide
| Severity level | ID | Name | Mechanism | Detail |
|---|