Drugs Information: Bimatoprost
Basic Information
|
||
| ID | DDInter207 | |
| Drug Type | small molecule | |
| Molecular Formula | C25H37No4 | |
| Molecular Weight | 415.574 | |
| Description | Bimatoprost is a prostaglandin analog used to treat hypotrichosis of the eyelashes and intraocular pressure in open angle glaucoma or ocular hypertension. | |
| ATC Classification | S01EE03 | |
| IUPAC Name | (5Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(1E,3S)-3-Hydroxy-5-Phenylpent-1-En-1-Yl]Cyclopentyl]-N-Ethylhept-5-Enamide | |
| InChI | Inchi=1S/C25H37No4/C1-2-26-25(30)13-9-4-3-8-12-21-22(24(29)18-23(21)28)17-16-20(27)15-14-19-10-6-5-7-11-19/H3,5-8,10-11,16-17,20-24,27-29H,2,4,9,12-15,18H2,1H3,(H,26,30)/B8-3-,17-16+/T20-,21+,22+,23-,24+/M0/S1 | |
| InChI Key | AQOKCDNYWBIDND-FTOWTWDKSA-N | |
| Canonical SMILES | CCNC(=O)CCC\C=C/C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1\C=C\[C@@H](O)CCC1=CC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Bimatoprost
| Severity level | ID | Name | Mechanism | Detail |
|---|