Drugs Information: Aclidinium
Basic Information
|
||
| ID | DDInter22 | |
| Drug Type | small molecule | |
| Molecular Formula | C26H30No4S2 | |
| Molecular Weight | 484.661 | |
| Description | Aclidinium is an inhaled long-acting anticholinergic used as a maintenance bronchodilator in patients with chronic obstructive pulmonary disease (COPD). | |
| ATC Classification | R03BB05 R03AL05 | |
| IUPAC Name | (3R)-3-{[2-Hydroxy-2,2-Bis(Thiophen-2-Yl)Acetyl]Oxy}-1-(3-Phenoxypropyl)-1-Azabicyclo[2.2.2]Octan-1-Ium | |
| InChI | Inchi=1S/C26H30No4S2/C28-25(26(29,23-9-4-17-32-23)24-10-5-18-33-24)31-22-19-27(14-11-20(22)12-15-27)13-6-16-30-21-7-2-1-3-8-21/H1-5,7-10,17-18,20,22,29H,6,11-16,19H2/Q+1/T20?,22-,27?/M0/S1 | |
| InChI Key | ASMXXROZKSBQIH-VITNCHFBSA-N | |
| Canonical SMILES | OC(C(=O)O[C@H]1C[N+]2(CCCOC3=CC=CC=C3)CCC1CC2)(C1=CC=CS1)C1=CC=CS1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Aclidinium
| Severity level | ID | Name | Mechanism | Detail |
|---|