Drugs Information: Boceprevir
Basic Information
|
||
| ID | DDInter221 | |
| Drug Type | small molecule | |
| Molecular Formula | C27H45N5O5 | |
| Molecular Weight | 519.687 | |
| Description | Boceprevir is a hepatitis C virus NS3/4A protease inhibitor used in combination with other medications to treat chronic hepatitis C genotype 1 infection. Boceprevir is not indicated as monotherapy. | |
| ATC Classification | J05AP03 | |
| IUPAC Name | 3-{[(1R,2S,5S)-3-[(2S)-2-[(Tert-Butylcarbamoyl)Amino]-3,3-Dimethylbutanoyl]-6,6-Dimethyl-3-Azabicyclo[3.1.0]Hexan-2-Yl]Formamido | |
| InChI | Inchi=1S/C27H45N5O5/C1-25(2,3)20(30-24(37)31-26(4,5)6)23(36)32-13-15-17(27(15,7)8)18(32)22(35)29-16(19(33)21(28)34)12-14-10-9-11-14/H14-18,20H,9-13H2,1-8H3,(H2,28,34)(H,29,35)(H2,30,31,37)/T15-,16?,17-,18-,20+/M0/S1 | |
| InChI Key | LHHCSNFAOIFYRV-DOVBMPENSA-N | |
| Canonical SMILES | [H][C@]12CN([C@H](C(=O)NC(CC3CCC3)C(=O)C(N)=O)[C@@]1([H])C2(C)C)C(=O)[C@@H](NC(=O)NC(C)(C)C)C(C)(C)C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Boceprevir
| Severity level | ID | Name | Mechanism | Detail |
|---|