Drugs Information: Bortezomib
Basic Information
|
||
| ID | DDInter222 | |
| Drug Type | small molecule | |
| Molecular Formula | C19H25Bn4O4 | |
| Molecular Weight | 384.244 | |
| Description | Bortezomib is a proteasome inhibitor used to treat multiple myeloma in patients who have not been successfully treated with at least two previous therapies. | |
| ATC Classification | L01XX32 | |
| IUPAC Name | [(1R)-3-Methyl-1-[(2S)-3-Phenyl-2-(Pyrazin-2-Ylformamido)Propanamido]Butyl]Boronic Acid | |
| InChI | Inchi=1S/C19H25Bn4O4/C1-13(2)10-17(20(27)28)24-18(25)15(11-14-6-4-3-5-7-14)23-19(26)16-12-21-8-9-22-16/H3-9,12-13,15,17,27-28H,10-11H2,1-2H3,(H,23,26)(H,24,25)/T15-,17-/M0/S1 | |
| InChI Key | GXJABQQUPOEUTA-RDJZCZTQSA-N | |
| Canonical SMILES | CC(C)C[C@H](NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C1=CN=CC=N1)B(O)O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Bortezomib
| Severity level | ID | Name | Mechanism | Detail |
|---|