Drugs Information: Bosentan
Basic Information
|
||
| ID | DDInter223 | |
| Drug Type | small molecule | |
| Molecular Formula | C27H29N5O6S | |
| Molecular Weight | 551.624 | |
| Description | Bosentan is a dual endothelin receptor antagonist used to treat pulmonary arterial hypertension. | |
| ATC Classification | G01AE10 C02KX01 | |
| IUPAC Name | 4-Tert-Butyl-N-[6-(2-Hydroxyethoxy)-5-(2-Methoxyphenoxy)-2-(Pyrimidin-2-Yl)Pyrimidin-4-Yl]Benzene-1-Sulfonamide | |
| InChI | Inchi=1S/C27H29N5O6S/C1-27(2,3)18-10-12-19(13-11-18)39(34,35)32-23-22(38-21-9-6-5-8-20(21)36-4)26(37-17-16-33)31-25(30-23)24-28-14-7-15-29-24/H5-15,33H,16-17H2,1-4H3,(H,30,31,32) | |
| InChI Key | GJPICJJJRGTNOD-UHFFFAOYSA-N | |
| Canonical SMILES | COC1=CC=CC=C1OC1=C(NS(=O)(=O)C2=CC=C(C=C2)C(C)(C)C)N=C(N=C1OCCO)C1=NC=CC=N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Bosentan
| Severity level | ID | Name | Mechanism | Detail |
|---|