Drugs Information: Brigatinib
Basic Information
|
||
| ID | DDInter233 | |
| Drug Type | small molecule | |
| Molecular Formula | C29H39Cln7O2P | |
| Molecular Weight | 584.105 | |
| Description | Brigatinib is an anaplastic lymphoma kinase inhibitor used to treat anaplastic lymphoma kinase positive metastatic non small cell lung cancer. | |
| ATC Classification | L01XE43 | |
| IUPAC Name | 5-Chloro-N4-[2-(Dimethylphosphoryl)Phenyl]-N2-{2-Methoxy-4-[4-(4-Methylpiperazin-1-Yl)Piperidin-1-Yl]Phenyl}Pyrimidine-2,4-Diami | |
| InChI | Inchi=1S/C29H39Cln7O2P/C1-35-15-17-37(18-16-35)21-11-13-36(14-12-21)22-9-10-24(26(19-22)39-2)33-29-31-20-23(30)28(34-29)32-25-7-5-6-8-27(25)40(3,4)38/H5-10,19-21H,11-18H2,1-4H3,(H2,31,32,33,34) | |
| InChI Key | AILRADAXUVEEIR-UHFFFAOYSA-N | |
| Canonical SMILES | COC1=CC(=CC=C1NC1=NC=C(Cl)C(NC2=CC=CC=C2P(C)(C)=O)=N1)N1CCC(CC1)N1CCN(C)CC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Brigatinib
| Severity level | ID | Name | Mechanism | Detail |
|---|