Drugs Information: Bromocriptine
Basic Information
|
|
||
| ID | DDInter243 | |
| Drug Type | small molecule | |
| Molecular Formula | C32H40Brn5O5 | |
| Molecular Weight | 654.606 | |
| Description | Bromocriptine is a dopamine D2 receptor agonist used for the treatment of galactorrhea due to hyperprolactinemia and other prolactin-related conditions, as well as in early Parkinsonian Syndrome. | |
| ATC Classification | N04BC01 G02CB01 | |
| IUPAC Name | (4R,7R)-10-Bromo-N-[(1S,2S,4R,7S)-2-Hydroxy-7-(2-Methylpropyl)-5,8-Dioxo-4-(Propan-2-Yl)-3-Oxa-6,9-Diazatricyclo[7.3.0.0^{2,6}]D | |
| InChI | Inchi=1S/C32H40Brn5O5/C1-16(2)12-24-29(40)37-11-7-10-25(37)32(42)38(24)30(41)31(43-32,17(3)4)35-28(39)18-13-20-19-8-6-9-22-26(19)21(27(33)34-22)14-23(20)36(5)15-18/H6,8-9,13,16-18,23-25,34,42H,7,10-12,14-15H2,1-5H3,(H,35,39)/T18-,23-,24+,25+,31-,32+/M1/S1 | |
| InChI Key | OZVBMTJYIDMWIL-AYFBDAFISA-N | |
| Canonical SMILES | [H][C@@]12CCCN1C(=O)[C@H](CC(C)C)N1C(=O)[C@](NC(=O)[C@H]3CN(C)[C@]4([H])CC5=C(Br)NC6=CC=CC(=C56)C4=C3)(O[C@@]21O)C(C)C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Bromocriptine
| Severity level | ID | Name | Mechanism | Detail |
|---|