Drugs Information: Bumetanide
Basic Information
|
||
| ID | DDInter248 | |
| Drug Type | small molecule | |
| Molecular Formula | C17H20N2O5S | |
| Molecular Weight | 364.422 | |
| Description | Bumetanide is a sulfamyl diuretic used to treat edema in congestive heart failure, hepatic and renal disease, and nephrotic syndrome. | |
| ATC Classification | G01AE10 C03CB02 C03EB02 C03CA02 | |
| IUPAC Name | 3-(Butylamino)-4-Phenoxy-5-Sulfamoylbenzoic Acid | |
| InChI | Inchi=1S/C17H20N2O5S/C1-2-3-9-19-14-10-12(17(20)21)11-15(25(18,22)23)16(14)24-13-7-5-4-6-8-13/H4-8,10-11,19H,2-3,9H2,1H3,(H,20,21)(H2,18,22,23) | |
| InChI Key | MAEIEVLCKWDQJH-UHFFFAOYSA-N | |
| Canonical SMILES | CCCCNC1=C(OC2=CC=CC=C2)C(=CC(=C1)C(O)=O)S(N)(=O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Bumetanide
| Severity level | ID | Name | Mechanism | Detail |
|---|