Drugs Information: Buprenorphine
Basic Information
|
||
| ID | DDInter251 | |
| Drug Type | small molecule | |
| Molecular Formula | C29H41No4 | |
| Molecular Weight | 467.650 | |
| Description | Buprenorphine is a partial opioid agonist used for management of severe pain that is not responsive to alternative treatments. Also used for maintenance treatment of opioid addiction. | |
| ATC Classification | N07BC01 N07BC51 N02AE01 | |
| IUPAC Name | (1S,2R,6S,14R,15R,16R)-3-(Cyclopropylmethyl)-16-[(2S)-2-Hydroxy-3,3-Dimethylbutan-2-Yl]-15-Methoxy-13-Oxa-3-Azahexacyclo[13.2.2. | |
| InChI | Inchi=1S/C29H41No4/C1-25(2,3)26(4,32)20-15-27-10-11-29(20,33-5)24-28(27)12-13-30(16-17-6-7-17)21(27)14-18-8-9-19(31)23(34-24)22(18)28/H8-9,17,20-21,24,31-32H,6-7,10-16H2,1-5H3/T20-,21-,24-,26+,27-,28+,29-/M1/S1 | |
| InChI Key | RMRJXGBAOAMLHD-IHFGGWKQSA-N | |
| Canonical SMILES | CO[C@]12CC[C@@]3(C[C@@H]1[C@](C)(O)C(C)(C)C)[C@H]1CC4=C5C(O[C@@H]2[C@@]35CCN1CC1CC1)=C(O)C=C4 | |
| Useful Links | DrugBank PubChem | |
Interactions with Buprenorphine
| Severity level | ID | Name | Mechanism | Detail |
|---|