Drugs Information: Cabergoline
Basic Information
|
||
| ID | DDInter260 | |
| Drug Type | small molecule | |
| Molecular Formula | C26H37N5O2 | |
| Molecular Weight | 451.615 | |
| Description | Cabergoline is a dopamine receptor agonist used for the treatment of hyperprolactinemic conditions due to various causes. | |
| ATC Classification | N04BC06 G02CB03 | |
| IUPAC Name | 1-[3-(Dimethylamino)Propyl]-3-Ethyl-1-[(2R,4R,7R)-6-(Prop-2-En-1-Yl)-6,11-Diazatetracyclo[7.6.1.0²,⁷.0¹²,¹⁶]Hexadeca-1(16),9,12, | |
| InChI | Inchi=1S/C26H37N5O2/C1-5-11-30-17-19(25(32)31(26(33)27-6-2)13-8-12-29(3)4)14-21-20-9-7-10-22-24(20)18(16-28-22)15-23(21)30/H5,7,9-10,16,19,21,23,28H,1,6,8,11-15,17H2,2-4H3,(H,27,33)/T19-,21-,23-/M1/S1 | |
| InChI Key | KORNTPPJEAJQIU-KJXAQDMKSA-N | |
| Canonical SMILES | [H][C@@]12CC3=CNC4=CC=CC(=C34)[C@@]1([H])C[C@H](CN2CC=C)C(=O)N(CCCN(C)C)C(=O)NCC | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Cabergoline
| Severity level | ID | Name | Mechanism | Detail |
|---|