Drugs Information: Calcitriol
Basic Information
|
|
||
| ID | DDInter268 | |
| Drug Type | small molecule | |
| Molecular Formula | C27H44O3 | |
| Molecular Weight | 416.646 | |
| Description | Calcitriol is an active metabolite of vitamin D that is used to treat hyperparathyroidism and is also used in dialysis patients to combat hypocalcemia. | |
| ATC Classification | D05AX03 A11CC04 | |
| IUPAC Name | (1R,3S,5Z)-5-{2-[(1R,3As,4E,7Ar)-1-[(2R)-6-Hydroxy-6-Methylheptan-2-Yl]-7A-Methyl-Octahydro-1H-Inden-4-Ylidene]Ethylidene}-4-Met | |
| InChI | Inchi=1S/C27H44O3/C1-18(8-6-14-26(3,4)30)23-12-13-24-20(9-7-15-27(23,24)5)10-11-21-16-22(28)17-25(29)19(21)2/H10-11,18,22-25,28-30H,2,6-9,12-17H2,1,3-5H3/B20-10+,21-11-/T18-,22-,23-,24+,25+,27-/M1/S1 | |
| InChI Key | GMRQFYUYWCNGIN-NKMMMXOESA-N | |
| Canonical SMILES | C[C@H](CCCC(C)(C)O)[C@@]1([H])CC[C@@]2([H])\C(CCC[C@]12C)=C\C=C1\C[C@@H](O)C[C@H](O)C1=C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Calcitriol
| Severity level | ID | Name | Mechanism | Detail |
|---|