|
| ID |
DDInter278 |
| Drug Type |
small molecule |
| Molecular Formula |
C6H10Cao6 |
| Molecular Weight |
218.218
|
| Description |
Calcium lactate is a salt that consists of two lactate anions for each calcium cation (Ca2+). It is prepared commercially by the neutralization of lactic acid with calcium carbonate or calcium hydroxide. Approved by the FDA as a direct food substance affirmed as generally recognized as safe, calcium lactate is used as a firming agent, flavoring agent, leavening agent, stabilizer, and thickener [L2741]. Calcium lactate is also found in daily dietary supplements as a source of calcium. It is also available in various hydrate forms, where calcium lactate pentahydrate is the most common.
|
| ATC Classification |
A12AA05
|
| IUPAC Name |
Calcium Bis(2-Hydroxypropanoate) |
| InChI |
Inchi=1S/2C3H6O3.Ca/C2*1-2(4)3(5)6;/H2*2,4H,1H3,(H,5,6);/Q;;+2/P-2 |
| InChI Key |
MKJXYGKVIBWPFZ-UHFFFAOYSA-L |
| Canonical SMILES |
[Ca++].CC(O)C([O-])=O.CC(O)C([O-])=O |
| Useful Links |
DrugBank
ChEMBL
|