Drugs Information: Capsaicin (topical)
Basic Information
|
||
| ID | DDInter290 | |
| Drug Type | small molecule | |
| Molecular Formula | C18H27No3 | |
| Molecular Weight | 305.418 | |
| Description | Capsaicin is a topical analgesic agent used for the symptomatic relief of neuropathic pain associated with post-herpetic neuralgia, as well as other muscle and joint pain. | |
| ATC Classification | M02AB01 N01BX04 | |
| IUPAC Name | (6E)-N-[(4-Hydroxy-3-Methoxyphenyl)Methyl]-8-Methylnon-6-Enamide | |
| InChI | Inchi=1S/C18H27No3/C1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/H6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/B8-6+ | |
| InChI Key | YKPUWZUDDOIDPM-SOFGYWHQSA-N | |
| Canonical SMILES | COC1=C(O)C=CC(CNC(=O)CCCC\C=C\C(C)C)=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Capsaicin (topical)
| Severity level | ID | Name | Mechanism | Detail |
|---|