Drugs Information: Carfilzomib
Basic Information
|
||
| ID | DDInter299 | |
| Drug Type | small molecule | |
| Molecular Formula | C40H57N5O7 | |
| Molecular Weight | 719.924 | |
| Description | Carfilzomib is a proteasome inhibitor used either alone or in conjunction with a chemotherapy regimen to treat patients with relapsed or refractory multiple myeloma. | |
| ATC Classification | L01XX45 | |
| IUPAC Name | (2S)-4-Methyl-N-[(1S)-1-{[(2S)-4-Methyl-1-[(2R)-2-Methyloxiran-2-Yl]-1-Oxopentan-2-Yl]Carbamoyl}-2-Phenylethyl]-2-[(2S)-2-[2-(Mo | |
| InChI | Inchi=1S/C40H57N5O7/C1-27(2)22-32(36(47)40(5)26-52-40)42-39(50)34(24-30-14-10-7-11-15-30)44-38(49)33(23-28(3)4)43-37(48)31(17-16-29-12-8-6-9-13-29)41-35(46)25-45-18-20-51-21-19-45/H6-15,27-28,31-34H,16-26H2,1-5H3,(H,41,46)(H,42,50)(H,43,48)(H,44,49)/T31-,32-,33-,34-,40+/M0/S1 | |
| InChI Key | BLMPQMFVWMYDKT-NZTKNTHTSA-N | |
| Canonical SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC1=CC=CC=C1)NC(=O)CN1CCOCC1)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC(C)C)C(=O)[C@@]1(C)CO1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Carfilzomib
| Severity level | ID | Name | Mechanism | Detail |
|---|