Drugs Information: Adefovir dipivoxil
Basic Information
|
||
| ID | DDInter30 | |
| Drug Type | small molecule | |
| Molecular Formula | C20H32N5O8P | |
| Molecular Weight | 501.477 | |
| Description | Adefovir dipivoxil is a nucleotide analog used to treat chronic hepatitis B. | |
| ATC Classification | J05AF08 | |
| IUPAC Name | [({[2-(6-Amino-9H-Purin-9-Yl)Ethoxy]Methyl}({[(2,2-Dimethylpropanoyl)Oxy]Methoxy})Phosphoryl)Oxy]Methyl 2,2-Dimethylpropanoate | |
| InChI | Inchi=1S/C20H32N5O8P/C1-19(2,3)17(26)30-11-32-34(28,33-12-31-18(27)20(4,5)6)13-29-8-7-25-10-24-14-15(21)22-9-23-16(14)25/H9-10H,7-8,11-13H2,1-6H3,(H2,21,22,23) | |
| InChI Key | WOZSCQDILHKSGG-UHFFFAOYSA-N | |
| Canonical SMILES | CC(C)(C)C(=O)OCOP(=O)(COCCN1C=NC2=C(N)N=CN=C12)OCOC(=O)C(C)(C)C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Adefovir dipivoxil
| Severity level | ID | Name | Mechanism | Detail |
|---|