Drugs Information: Carisoprodol
Basic Information
|
||
| ID | DDInter301 | |
| Drug Type | small molecule | |
| Molecular Formula | C12H24N2O4 | |
| Molecular Weight | 260.334 | |
| Description | Carisoprodol is a centrally acting muscle relaxant used to relieve the discomfort associated with various musculoskeletal conditions. | |
| ATC Classification | M03BA02 M03BA72 M03BA52 | |
| IUPAC Name | 2-[(Carbamoyloxy)Methyl]-2-Methylpentyl N-(Propan-2-Yl)Carbamate | |
| InChI | Inchi=1S/C12H24N2O4/C1-5-6-12(4,7-17-10(13)15)8-18-11(16)14-9(2)3/H9H,5-8H2,1-4H3,(H2,13,15)(H,14,16) | |
| InChI Key | OFZCIYFFPZCNJE-UHFFFAOYSA-N | |
| Canonical SMILES | CCCC(C)(COC(N)=O)COC(=O)NC(C)C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Carisoprodol
| Severity level | ID | Name | Mechanism | Detail |
|---|