Drugs Information: Cefaclor
Basic Information
|
||
| ID | DDInter309 | |
| Drug Type | small molecule | |
| Molecular Formula | C15H14Cln3O4S | |
| Molecular Weight | 367.813 | |
| Description | Cefaclor is a second generation cephalosporin used to treat a wide variety of infections in the body. | |
| ATC Classification | J01DC04 | |
| IUPAC Name | (6R,7R)-7-[(2R)-2-Amino-2-Phenylacetamido]-3-Chloro-8-Oxo-5-Thia-1-Azabicyclo[4.2.0]Oct-2-Ene-2-Carboxylic Acid | |
| InChI | Inchi=1S/C15H14Cln3O4S/C16-8-6-24-14-10(13(21)19(14)11(8)15(22)23)18-12(20)9(17)7-4-2-1-3-5-7/H1-5,9-10,14H,6,17H2,(H,18,20)(H,22,23)/T9-,10-,14-/M1/S1 | |
| InChI Key | QYIYFLOTGYLRGG-GPCCPHFNSA-N | |
| Canonical SMILES | [H][C@]12SCC(Cl)=C(N1C(=O)[C@H]2NC(=O)[C@H](N)C1=CC=CC=C1)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Cefaclor
| Severity level | ID | Name | Mechanism | Detail |
|---|