Drugs Information: Cefdinir
Basic Information
|
||
| ID | DDInter315 | |
| Drug Type | small molecule | |
| Molecular Formula | C14H13N5O5S2 | |
| Molecular Weight | 395.420 | |
| Description | Cefdinir is a third generation cephalosporin used to treat susceptible Gram negative and Gram positive bacterial infections. | |
| ATC Classification | J01DD15 | |
| IUPAC Name | (6R,7R)-7-[(2Z)-2-(2-Amino-1,3-Thiazol-4-Yl)-2-(N-Hydroxyimino)Acetamido]-3-Ethenyl-8-Oxo-5-Thia-1-Azabicyclo[4.2.0]Oct-2-Ene-2- | |
| InChI | Inchi=1S/C14H13N5O5S2/C1-2-5-3-25-12-8(11(21)19(12)9(5)13(22)23)17-10(20)7(18-24)6-4-26-14(15)16-6/H2,4,8,12,24H,1,3H2,(H2,15,16)(H,17,20)(H,22,23)/B18-7-/T8-,12-/M1/S1 | |
| InChI Key | RTXOFQZKPXMALH-GHXIOONMSA-N | |
| Canonical SMILES | [H][C@]12SCC(C=C)=C(N1C(=O)[C@H]2NC(=O)C(=N/O)\C1=CSC(N)=N1)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Cefdinir
| Severity level | ID | Name | Mechanism | Detail |
|---|