Drugs Information: Cefditoren
Basic Information
|
||
ID | DDInter316 | |
Drug Type | small molecule | |
Molecular Formula | C19H18N6O5S3 | |
Molecular Weight | 506.588 | |
Description | Cefditoren is a broad-spectrum third-generation cephalosporin antibiotic typically used to treat bacterial infections of the skin and respiratory tract. | |
ATC Classification | J01DD16 | |
IUPAC Name | (6R,7R)-7-[(2Z)-2-(2-Amino-1,3-Thiazol-4-Yl)-2-(Methoxyimino)Acetamido]-3-[(Z)-2-(4-Methyl-1,3-Thiazol-5-Yl)Ethenyl]-8-Oxo-5-Thi | |
InChI | Inchi=1S/C19H18N6O5S3/C1-8-11(33-7-21-8)4-3-9-5-31-17-13(16(27)25(17)14(9)18(28)29)23-15(26)12(24-30-2)10-6-32-19(20)22-10/H3-4,6-7,13,17H,5H2,1-2H3,(H2,20,22)(H,23,26)(H,28,29)/B4-3-,24-12-/T13-,17-/M1/S1 | |
InChI Key | KMIPKYQIOVAHOP-YLGJWRNMSA-N | |
Canonical SMILES | [H][C@]12SCC(\C=C/C3=C(C)N=CS3)=C(N1C(=O)[C@H]2NC(=O)C(=N/OC)\C1=CSC(N)=N1)C(O)=O | |
Useful Links | DrugBank ChEMBL PubChem |
Interactions with Cefditoren
Severity level | ID | Name | Mechanism | Detail |
---|