Drugs Information: Cefonicid
Basic Information
|
|
||
| ID | DDInter321 | |
| Drug Type | small molecule | |
| Molecular Formula | C18H18N6O8S3 | |
| Molecular Weight | 542.574 | |
| Description | A second-generation cephalosporin administered intravenously or intramuscularly. Its bactericidal action results from inhibition of cell wall synthesis. It is used for urinary tract infections, lower respiratory tract infections, and soft tissue and bone infections. | |
| ATC Classification | J01DC06 | |
| IUPAC Name | (6R,7R)-7-[(2R)-2-Hydroxy-2-Phenylacetamido]-8-Oxo-3-({[1-(Sulfomethyl)-1H-1,2,3,4-Tetrazol-5-Yl]Sulfanyl}Methyl)-5-Thia-1-Azabi | |
| InChI | Inchi=1S/C18H18N6O8S3/C25-13(9-4-2-1-3-5-9)14(26)19-11-15(27)24-12(17(28)29)10(6-33-16(11)24)7-34-18-20-21-22-23(18)8-35(30,31)32/H1-5,11,13,16,25H,6-8H2,(H,19,26)(H,28,29)(H,30,31,32)/T11-,13-,16-/M1/S1 | |
| InChI Key | DYAIAHUQIPBDIP-AXAPSJFSSA-N | |
| Canonical SMILES | [H][C@]12SCC(CSC3=NN=NN3CS(O)(=O)=O)=C(N1C(=O)[C@H]2NC(=O)[C@H](O)C1=CC=CC=C1)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Cefonicid
| Severity level | ID | Name | Mechanism | Detail |
|---|