Drugs Information: Cefotaxime
Basic Information
|
||
| ID | DDInter323 | |
| Drug Type | small molecule | |
| Molecular Formula | C16H17N5O7S2 | |
| Molecular Weight | 455.472 | |
| Description | Cefotaxime is a third generation cephalosporin used to treat susceptible Gram negative and Gram positive bacterial infections. | |
| ATC Classification | J01DD01 | |
| IUPAC Name | (6R,7R)-3-[(Acetyloxy)Methyl]-7-[(2Z)-2-(2-Amino-1,3-Thiazol-4-Yl)-2-(Methoxyimino)Acetamido]-8-Oxo-5-Thia-1-Azabicyclo[4.2.0]Oc | |
| InChI | Inchi=1S/C16H17N5O7S2/C1-6(22)28-3-7-4-29-14-10(13(24)21(14)11(7)15(25)26)19-12(23)9(20-27-2)8-5-30-16(17)18-8/H5,10,14H,3-4H2,1-2H3,(H2,17,18)(H,19,23)(H,25,26)/B20-9-/T10-,14-/M1/S1 | |
| InChI Key | GPRBEKHLDVQUJE-QSWIMTSFSA-N | |
| Canonical SMILES | [H][C@]12SCC(COC(C)=O)=C(N1C(=O)[C@H]2NC(=O)C(=N/OC)\C1=CSC(N)=N1)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Cefotaxime
| Severity level | ID | Name | Mechanism | Detail |
|---|