Drugs Information: Cefprozil
Basic Information
|
||
| ID | DDInter327 | |
| Drug Type | small molecule | |
| Molecular Formula | C18H19N3O5S | |
| Molecular Weight | 389.432 | |
| Description | Cefprozil is a cephalosporin antibiotic used in the treatment of various bacterial infections, such as pharyngitis, tonsillitis, otitis media, and uncomplicated skin infections. | |
| ATC Classification | J01DC10 | |
| IUPAC Name | (6R,7R)-7-[(2R)-2-Amino-2-(4-Hydroxyphenyl)Acetamido]-8-Oxo-3-(Prop-1-En-1-Yl)-5-Thia-1-Azabicyclo[4.2.0]Oct-2-Ene-2-Carboxylic | |
| InChI | Inchi=1S/C18H19N3O5S/C1-2-3-10-8-27-17-13(16(24)21(17)14(10)18(25)26)20-15(23)12(19)9-4-6-11(22)7-5-9/H2-7,12-13,17,22H,8,19H2,1H3,(H,20,23)(H,25,26)/B3-2+/T12-,13-,17-/M1/S1 | |
| InChI Key | WDLWHQDACQUCJR-ZAMMOSSLSA-N | |
| Canonical SMILES | [H][C@]12SCC(C=CC)=C(N1C(=O)[C@@]2([H])NC(=O)[C@H](N)C1=CC=C(O)C=C1)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Cefprozil
| Severity level | ID | Name | Mechanism | Detail |
|---|