Drugs Information: Cefradine
Basic Information
|
||
| ID | DDInter328 | |
| Drug Type | small molecule | |
| Molecular Formula | C16H19N3O4S | |
| Molecular Weight | 349.411 | |
| Description | Cefradine is a first-generation cephalosporin antibiotic used in the treatment of bacterial infections of the respiratory and urinary tracts and of the skin and soft tissues. | |
| ATC Classification | J01DB09 | |
| IUPAC Name | (6R,7R)-7-[(2R)-2-Amino-2-(Cyclohexa-1,4-Dien-1-Yl)Acetamido]-3-Methyl-8-Oxo-5-Thia-1-Azabicyclo[4.2.0]Oct-2-Ene-2-Carboxylic Ac | |
| InChI | Inchi=1S/C16H19N3O4S/C1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/H2-3,6,10-11,15H,4-5,7,17H2,1H3,(H,18,20)(H,22,23)/T10-,11-,15-/M1/S1 | |
| InChI Key | RDLPVSKMFDYCOR-UEKVPHQBSA-N | |
| Canonical SMILES | [H][C@]12SCC(C)=C(N1C(=O)[C@H]2NC(=O)[C@H](N)C1=CCC=CC1)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Cefradine
| Severity level | ID | Name | Mechanism | Detail |
|---|