Drugs Information: Ceftazidime
Basic Information
|
||
| ID | DDInter330 | |
| Drug Type | small molecule | |
| Molecular Formula | C22H22N6O7S2 | |
| Molecular Weight | 546.585 | |
| Description | Ceftazidime is an injected broad-spectrum third-generation cephalosporin beta-lactam antibiotic used to treat or prevent a variety of bacterial infections, including pneumonia, gynecological infections, bone and joint infections, and septicemia, among others. | |
| ATC Classification | J01DD02 | |
| IUPAC Name | 1-{[(6R,7R)-7-[(2Z)-2-(2-Amino-1,3-Thiazol-4-Yl)-2-[(1-Carboxy-1-Methylethoxy)Imino]Acetamido]-2-Carboxylato-8-Oxo-5-Thia-1-Azab | |
| InChI | Inchi=1S/C22H22N6O7S2/C1-22(2,20(33)34)35-26-13(12-10-37-21(23)24-12)16(29)25-14-17(30)28-15(19(31)32)11(9-36-18(14)28)8-27-6-4-3-5-7-27/H3-7,10,14,18H,8-9H2,1-2H3,(H4-,23,24,25,29,31,32,33,34)/B26-13-/T14-,18-/M1/S1 | |
| InChI Key | ORFOPKXBNMVMKC-DWVKKRMSSA-N | |
| Canonical SMILES | [O-]C(=O)C1=C(CS[C@]2([H])[C@H](NC(=O)C(=N/OC(C)(C)C(O)=O)\C3=CSC(N)=N3)C(=O)N12)C[N+]1=CC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Ceftazidime
| Severity level | ID | Name | Mechanism | Detail |
|---|