Drugs Information: Ceftibuten
Basic Information
|
||
| ID | DDInter331 | |
| Drug Type | small molecule | |
| Molecular Formula | C15H14N4O6S2 | |
| Molecular Weight | 410.431 | |
| Description | Ceftibuten is a third-generation cephalosporin antibiotic commonly used in the treatment of acute bacterial exacerbations of chronic bronchitis (ABECB), acute bacterial otitis media, pharyngitis, and tonsillitis. | |
| ATC Classification | J01DD14 | |
| IUPAC Name | (6R,7R)-7-[(2Z)-2-(2-Amino-1,3-Thiazol-4-Yl)-4-Carboxybut-2-Enamido]-8-Oxo-5-Thia-1-Azabicyclo[4.2.0]Oct-2-Ene-2-Carboxylic Acid | |
| InChI | Inchi=1S/C15H14N4O6S2/C16-15-17-7(5-27-15)6(1-2-9(20)21)11(22)18-10-12(23)19-8(14(24)25)3-4-26-13(10)19/H1,3,5,10,13H,2,4H2,(H2,16,17)(H,18,22)(H,20,21)(H,24,25)/B6-1-/T10-,13-/M1/S1 | |
| InChI Key | UNJFKXSSGBWRBZ-BJCIPQKHSA-N | |
| Canonical SMILES | [H][C@]12SCC=C(N1C(=O)[C@H]2NC(=O)C(=C/CC(O)=O)\C1=CSC(N)=N1)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Ceftibuten
| Severity level | ID | Name | Mechanism | Detail |
|---|