Drugs Information: Albendazole
Basic Information
|
||
| ID | DDInter35 | |
| Drug Type | small molecule | |
| Molecular Formula | C12H15N3O2S | |
| Molecular Weight | 265.337 | |
| Description | Albendazole is a benzimidazole anthelmintic used to treat parenchymal neurocysticercosis and other helminth infections. | |
| ATC Classification | P02CA03 | |
| IUPAC Name | Methyl N-[6-(Propylsulfanyl)-1H-1,3-Benzodiazol-2-Yl]Carbamate | |
| InChI | Inchi=1S/C12H15N3O2S/C1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2/H4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16) | |
| InChI Key | HXHWSAZORRCQMX-UHFFFAOYSA-N | |
| Canonical SMILES | CCCSC1=CC2=C(C=C1)N=C(NC(=O)OC)N2 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Albendazole
| Severity level | ID | Name | Mechanism | Detail |
|---|