Drugs Information: Chlorhexidine
Basic Information
|
||
| ID | DDInter356 | |
| Drug Type | small molecule | |
| Molecular Formula | C22H30Cl2N10 | |
| Molecular Weight | 505.458 | |
| Description | Chlorhexidine is an antiseptic used to sterilize for surgeries and in healthcare practice, to reduce pocket depth in periodontitis, and to treat gingivitis. | |
| ATC Classification | R02AA05 S03AA04 D08AC52 D08AC02 S01AX09 More | |
| IUPAC Name | N-(4-Chlorophenyl)-1-3-(6-{N-[3-(4-Chlorophenyl)Carbamimidamidomethanimidoyl]Amino}Hexyl)Carbamimidamidomethanimidamide | |
| InChI | Inchi=1S/C22H30Cl2N10/C23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18/H5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34) | |
| InChI Key | GHXZTYHSJHQHIJ-UHFFFAOYSA-N | |
| Canonical SMILES | ClC1=CC=C(NC(=N)NC(=N)NCCCCCCNC(=N)NC(=N)NC2=CC=C(Cl)C=C2)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Chlorhexidine
| Severity level | ID | Name | Mechanism | Detail |
|---|