Drugs Information: Chlorpropamide
Basic Information
|
||
| ID | DDInter364 | |
| Drug Type | small molecule | |
| Molecular Formula | C10H13Cln2O3S | |
| Molecular Weight | 276.744 | |
| Description | Chlorpropamide is a sulfonylurea used in the treatment of non insulin dependent diabetes mellitus. | |
| ATC Classification | A10BB02 | |
| IUPAC Name | 1-(4-Chlorobenzenesulfonyl)-3-Propylurea | |
| InChI | Inchi=1S/C10H13Cln2O3S/C1-2-7-12-10(14)13-17(15,16)9-5-3-8(11)4-6-9/H3-6H,2,7H2,1H3,(H2,12,13,14) | |
| InChI Key | RKWGIWYCVPQPMF-UHFFFAOYSA-N | |
| Canonical SMILES | CCCNC(=O)NS(=O)(=O)C1=CC=C(Cl)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Chlorpropamide
| Severity level | ID | Name | Mechanism | Detail |
|---|