Drugs Information: Cidofovir
Basic Information
|
||
| ID | DDInter378 | |
| Drug Type | small molecule | |
| Molecular Formula | C8H14N3O6P | |
| Molecular Weight | 279.189 | |
| Description | Cidofovir is an antiviral agent used to treat Cytomegalovirus (CMV) retinitis in patients with AIDS. | |
| ATC Classification | J05AB12 | |
| IUPAC Name | ({[(2S)-1-(4-Amino-2-Oxo-1,2-Dihydropyrimidin-1-Yl)-3-Hydroxypropan-2-Yl]Oxy}Methyl)Phosphonic Acid | |
| InChI | Inchi=1S/C8H14N3O6P/C9-7-1-2-11(8(13)10-7)3-6(4-12)17-5-18(14,15)16/H1-2,6,12H,3-5H2,(H2,9,10,13)(H2,14,15,16)/T6-/M0/S1 | |
| InChI Key | VWFCHDSQECPREK-LURJTMIESA-N | |
| Canonical SMILES | NC1=NC(=O)N(C[C@@H](CO)OCP(O)(O)=O)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Cidofovir
| Severity level | ID | Name | Mechanism | Detail |
|---|