Drugs Information: Cisplatin
Basic Information
|
||
| ID | DDInter387 | |
| Drug Type | small molecule | |
| Molecular Formula | Cl2H6N2Pt | |
| Molecular Weight | - | |
| Description | Cisplatin is a platinum based chemotherapy agent used to treat various sarcomas, carcinomas, lymphomas, and germ cell tumors. | |
| ATC Classification | L01XA01 | |
| IUPAC Name | Dichloroplatinumdiamine | |
| InChI | Inchi=1S/2Clh.2H3N.Pt/H2*1H;2*1H3;/Q;;;;+2/P-2 | |
| InChI Key | LXZZYRPGZAFOLE-UHFFFAOYSA-L | |
| Canonical SMILES | [H][N]([H])([H])[Pt](Cl)(Cl)[N]([H])([H])[H] | |
| Useful Links | DrugBank PubChem | |
Interactions with Cisplatin
| Severity level | ID | Name | Mechanism | Detail |
|---|