Drugs Information: Citicoline
Basic Information
|
||
| ID | DDInter389 | |
| Drug Type | small molecule | |
| Molecular Formula | C14H26N4O11P2 | |
| Molecular Weight | 488.327 | |
| Description | Citicoline is an endogenous intermediate in the formation of phosphatidylcholine from choline which is thought to have neuroprotective effects. | |
| ATC Classification | N06BX06 | |
| IUPAC Name | {2-[({[(2R,3S,4R,5R)-5-(4-Amino-2-Oxo-1,2-Dihydropyrimidin-1-Yl)-3,4-Dihydroxyoxolan-2-Yl]Methoxy}(Hydroxy)Phosphoryl Phosphono) | |
| InChI | Inchi=1S/C14H26N4O11P2/C1-18(2,3)6-7-26-30(22,23)29-31(24,25)27-8-9-11(19)12(20)13(28-9)17-5-4-10(15)16-14(17)21/H4-5,9,11-13,19-20H,6-8H2,1-3H3,(H3-,15,16,21,22,23,24,25)/T9-,11-,12-,13-/M1/S1 | |
| InChI Key | RZZPDXZPRHQOCG-OJAKKHQRSA-N | |
| Canonical SMILES | C[N+](C)(C)CCOP([O-])(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=CC(N)=NC1=O | |
| Useful Links | DrugBank ChEMBL | |
Interactions with Citicoline
| Severity level | ID | Name | Mechanism | Detail |
|---|