Drugs Information: Clemastine
Basic Information
|
||
| ID | DDInter395 | |
| Drug Type | small molecule | |
| Molecular Formula | C21H26Clno | |
| Molecular Weight | 343.898 | |
| Description | Clemastine is an antihistamine with sedative and anticholinergic effects used to treat the symptoms of allergic rhinitis. | |
| ATC Classification | D04AA14 R06AA54 R06AA04 | |
| IUPAC Name | (2R)-2-{2-[(1R)-1-(4-Chlorophenyl)-1-Phenylethoxy]Ethyl}-1-Methylpyrrolidine | |
| InChI | Inchi=1S/C21H26Clno/C1-21(17-7-4-3-5-8-17,18-10-12-19(22)13-11-18)24-16-14-20-9-6-15-23(20)2/H3-5,7-8,10-13,20H,6,9,14-16H2,1-2H3/T20-,21-/M1/S1 | |
| InChI Key | YNNUSGIPVFPVBX-NHCUHLMSSA-N | |
| Canonical SMILES | CN1CCC[C@@H]1CCO[C@](C)(C1=CC=CC=C1)C1=CC=C(Cl)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Clemastine
| Severity level | ID | Name | Mechanism | Detail |
|---|