Drugs Information: Clioquinol (topical)
Basic Information
|
||
| ID | DDInter400 | |
| Drug Type | small molecule | |
| Molecular Formula | C9H5Clino | |
| Molecular Weight | 305.502 | |
| Description | Clioquinol is an antifungal cream used to treat a variety of fungal infections. | |
| ATC Classification | G01AC02 S02AA05 D09AA10 P01AA02 P01AA52 More | |
| IUPAC Name | 5-Chloro-7-Iodoquinolin-8-Ol | |
| InChI | Inchi=1S/C9H5Clino/C10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/H1-4,13H | |
| InChI Key | QCDFBFJGMNKBDO-UHFFFAOYSA-N | |
| Canonical SMILES | OC1=C(I)C=C(Cl)C2=C1N=CC=C2 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Clioquinol (topical)
| Severity level | ID | Name | Mechanism | Detail |
|---|