Drugs Information: Clobetasol (topical)
Basic Information
|
||
| ID | DDInter403 | |
| Drug Type | small molecule | |
| Molecular Formula | C22H28Clfo4 | |
| Molecular Weight | 410.913 | |
| Description | Clobetasol is under investigation for the treatment of Scleroderma. Clobetasol has been investigated for the prevention of Psoriasis and Cutaneous Atrophy Due to Corticosteroids. | |
| ATC Classification | D07AD01 D07CD01 | |
| IUPAC Name | (1R,2S,10S,11S,13S,14R,15S,17S)-14-(2-Chloroacetyl)-1-Fluoro-14,17-Dihydroxy-2,13,15-Trimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]Hepta | |
| InChI | Inchi=1S/C22H28Clfo4/C1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,24)17(26)10-20(16,3)22(12,28)18(27)11-23/H6-7,9,12,15-17,26,28H,4-5,8,10-11H2,1-3H3/T12-,15-,16-,17-,19-,20-,21-,22-/M0/S1 | |
| InChI Key | FCSHDIVRCWTZOX-DVTGEIKXSA-N | |
| Canonical SMILES | [H][C@@]12C[C@H](C)[C@](O)(C(=O)CCl)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Clobetasol (topical)
| Severity level | ID | Name | Mechanism | Detail |
|---|