Drugs Information: Clofibrate
Basic Information
|
||
| ID | DDInter408 | |
| Drug Type | small molecule | |
| Molecular Formula | C12H15Clo3 | |
| Molecular Weight | 242.702 | |
| Description | Clofibrate is a fibric acid derivative used to treat hypertriglyceridemia and high cholesterol. | |
| ATC Classification | C10AB01 | |
| IUPAC Name | Ethyl 2-(4-Chlorophenoxy)-2-Methylpropanoate | |
| InChI | Inchi=1S/C12H15Clo3/C1-4-15-11(14)12(2,3)16-10-7-5-9(13)6-8-10/H5-8H,4H2,1-3H3 | |
| InChI Key | KNHUKKLJHYUCFP-UHFFFAOYSA-N | |
| Canonical SMILES | CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Clofibrate
| Severity level | ID | Name | Mechanism | Detail |
|---|