Drugs Information: Alendronic acid
Basic Information
|
||
| ID | DDInter42 | |
| Drug Type | small molecule | |
| Molecular Formula | C4H13No7P2 | |
| Molecular Weight | 249.096 | |
| Description | Alendronic acid is a bisphosphonate drug that prevents osteoclastic bone resorption which is used for the prevention and treatment of osteoporosis. | |
| ATC Classification | M05BB03 M05BA04 M05BB06 M05BB05 | |
| IUPAC Name | (4-Amino-1-Hydroxy-1-Phosphonobutyl)Phosphonic Acid | |
| InChI | Inchi=1S/C4H13No7P2/C5-3-1-2-4(6,13(7,8)9)14(10,11)12/H6H,1-3,5H2,(H2,7,8,9)(H2,10,11,12) | |
| InChI Key | OGSPWJRAVKPPFI-UHFFFAOYSA-N | |
| Canonical SMILES | NCCCC(O)(P(O)(O)=O)P(O)(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Alendronic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|