Drugs Information: Cobicistat
Basic Information
|
||
| ID | DDInter424 | |
| Drug Type | small molecule | |
| Molecular Formula | C40H53N7O5S2 | |
| Molecular Weight | 776.040 | |
| Description | Cobicistat is a CYP3A inhibitor used to increase the systemic exposure of atazanavir or darunavir in combination with other antiretroviral agents in the treatment of HIV-1 infection. | |
| ATC Classification | J05AR09 J05AR15 J05AR14 J05AR22 J05AR18 More | |
| IUPAC Name | (1,3-Thiazol-5-Yl)Methyl N-[(2R,5R)-5-[(2S)-2-{[Methyl({[2-(Propan-2-Yl)-1,3-Thiazol-4-Yl]Methyl})Carbamoyl]Amino}-4-(Morpholin- | |
| InChI | Inchi=1S/C40H53N7O5S2/C1-29(2)38-43-34(27-53-38)25-46(3)39(49)45-36(16-17-47-18-20-51-21-19-47)37(48)42-32(22-30-10-6-4-7-11-30)14-15-33(23-31-12-8-5-9-13-31)44-40(50)52-26-35-24-41-28-54-35/H4-13,24,27-29,32-33,36H,14-23,25-26H2,1-3H3,(H,42,48)(H,44,50)(H,45,49)/T32-,33-,36+/M1/S1 | |
| InChI Key | ZCIGNRJZKPOIKD-CQXVEOKZSA-N | |
| Canonical SMILES | CC(C)C1=NC(CN(C)C(=O)N[C@@H](CCN2CCOCC2)C(=O)N[C@H](CC[C@H](CC2=CC=CC=C2)NC(=O)OCC2=CN=CS2)CC2=CC=CC=C2)=CS1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Cobicistat
| Severity level | ID | Name | Mechanism | Detail |
|---|