Drugs Information: Alfuzosin
Basic Information
|
||
| ID | DDInter44 | |
| Drug Type | small molecule | |
| Molecular Formula | C19H27N5O4 | |
| Molecular Weight | 389.456 | |
| Description | Alfuzosin is an alpha-1 adrenergic antagonist used in the symptomatic management of benign prostatic hypertrophy (BPH). | |
| ATC Classification | G04CA01 G04CA51 | |
| IUPAC Name | N-{3-[(4-Amino-6,7-Dimethoxyquinazolin-2-Yl)(Methyl)Amino]Propyl}Oxolane-2-Carboxamide | |
| InChI | Inchi=1S/C19H27N5O4/C1-24(8-5-7-21-18(25)14-6-4-9-28-14)19-22-13-11-16(27-3)15(26-2)10-12(13)17(20)23-19/H10-11,14H,4-9H2,1-3H3,(H,21,25)(H2,20,22,23) | |
| InChI Key | WNMJYKCGWZFFKR-UHFFFAOYSA-N | |
| Canonical SMILES | COC1=CC2=C(C=C1OC)C(N)=NC(=N2)N(C)CCCNC(=O)C1CCCO1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Alfuzosin
| Severity level | ID | Name | Mechanism | Detail |
|---|