Drugs Information: Cycloserine
Basic Information
|
||
| ID | DDInter457 | |
| Drug Type | small molecule | |
| Molecular Formula | C3H6N2O2 | |
| Molecular Weight | 102.093 | |
| Description | Cycloserine is a broad-spectrum antibiotic used in the treatment of tuberculosis and certain urinary tract infections (UTI). | |
| ATC Classification | J04AB01 | |
| IUPAC Name | (4R)-4-Amino-1,2-Oxazolidin-3-One | |
| InChI | Inchi=1S/C3H6N2O2/C4-2-1-7-5-3(2)6/H2H,1,4H2,(H,5,6)/T2-/M1/S1 | |
| InChI Key | DYDCUQKUCUHJBH-UWTATZPHSA-N | |
| Canonical SMILES | N[C@@H]1CONC1=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Cycloserine
| Severity level | ID | Name | Mechanism | Detail |
|---|