Drugs Information: Dacomitinib
Basic Information
|
||
| ID | DDInter465 | |
| Drug Type | small molecule | |
| Molecular Formula | C24H25Clfn5O2 | |
| Molecular Weight | 469.948 | |
| Description | Dacomitinib is a medication used to treat non small cell lung cancer with EGFR exon 19 deletion of exon 21 L858R substitution. | |
| ATC Classification | L01XE47 | |
| IUPAC Name | (2E)-N-{4-[(3-Chloro-4-Fluorophenyl)Amino]-7-Methoxyquinazolin-6-Yl}-4-(Piperidin-1-Yl)But-2-Enamide | |
| InChI | Inchi=1S/C24H25Clfn5O2/C1-33-22-14-20-17(24(28-15-27-20)29-16-7-8-19(26)18(25)12-16)13-21(22)30-23(32)6-5-11-31-9-3-2-4-10-31/H5-8,12-15H,2-4,9-11H2,1H3,(H,30,32)(H,27,28,29)/B6-5+ | |
| InChI Key | LVXJQMNHJWSHET-AATRIKPKSA-N | |
| Canonical SMILES | COC1=C(NC(=O)\C=C\CN2CCCCC2)C=C2C(NC3=CC(Cl)=C(F)C=C3)=NC=NC2=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Dacomitinib
| Severity level | ID | Name | Mechanism | Detail |
|---|