Drugs Information: Darunavir
Basic Information
|
||
| ID | DDInter482 | |
| Drug Type | small molecule | |
| Molecular Formula | C27H37N3O7S | |
| Molecular Weight | 547.673 | |
| Description | Darunavir is a HIV protease inhibitor used in the treatment of human immunodeficiency virus (HIV) infection in patients with history of prior antiretroviral therapies. | |
| ATC Classification | J05AR14 G01AE10 J05AR22 J05AR26 J05AE10 | |
| IUPAC Name | (3R,3As,6Ar)-Hexahydrofuro[2,3-B]Furan-3-Yl N-[(2S,3R)-3-Hydroxy-4-[N-(2-Methylpropyl)4-Aminobenzenesulfonamido]-1-Phenylbutan-2 | |
| InChI | Inchi=1S/C27H37N3O7S/C1-18(2)15-30(38(33,34)21-10-8-20(28)9-11-21)16-24(31)23(14-19-6-4-3-5-7-19)29-27(32)37-25-17-36-26-22(25)12-13-35-26/H3-11,18,22-26,31H,12-17,28H2,1-2H3,(H,29,32)/T22-,23-,24+,25-,26+/M0/S1 | |
| InChI Key | CJBJHOAVZSMMDJ-HEXNFIEUSA-N | |
| Canonical SMILES | [H][C@@]12CCO[C@]1([H])OC[C@@H]2OC(=O)N[C@@H](CC1=CC=CC=C1)[C@H](O)CN(CC(C)C)S(=O)(=O)C1=CC=C(N)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Darunavir
| Severity level | ID | Name | Mechanism | Detail |
|---|