Drugs Information: Dexmethylphenidate
Basic Information
|
||
| ID | DDInter521 | |
| Drug Type | small molecule | |
| Molecular Formula | C14H19No2 | |
| Molecular Weight | 233.311 | |
| Description | Dexmethylphenidate is a norepinephrine-dopamine reuptake inhibitor used in the treatment of ADHD in conjunction with other therapies. | |
| ATC Classification | N06BA11 | |
| IUPAC Name | Methyl (2R)-2-Phenyl-2-[(2R)-Piperidin-2-Yl]Acetate | |
| InChI | Inchi=1S/C14H19No2/C1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12/H2-4,7-8,12-13,15H,5-6,9-10H2,1H3/T12-,13-/M1/S1 | |
| InChI Key | DUGOZIWVEXMGBE-CHWSQXEVSA-N | |
| Canonical SMILES | [H][C@@](C(=O)OC)(C1=CC=CC=C1)[C@@]1([H])CCCCN1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Dexmethylphenidate
| Severity level | ID | Name | Mechanism | Detail |
|---|